C22H40N2O4 — CID 69011772
N,N'-bis[(1R)-1-(1-hydroxycyclopentyl)-2,2-dimethylpropyl]oxamide (PubChem CID 69011772) has the molecular formula C22H40N2O4 and a molecular weight of 396.57 g/mol. Its IUPAC name is N,N'-bis[(1R)-1-(1-hydroxycyclopentyl)-2,2-dimethylpropyl]oxamide.
| Compound Name | N,N'-bis[(1R)-1-(1-hydroxycyclopentyl)-2,2-dimethylpropyl]oxamide |
|---|---|
| PubChem CID | 69011772 |
| Molecular Formula | C22H40N2O4 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | N,N'-bis[(1R)-1-(1-hydroxycyclopentyl)-2,2-dimethylpropyl]oxamide |
| SMILES | CC(C)(C)[C@@H](NC(=O)C(=O)N[C@H](C(C)(C)C)C1(O)CCCC1)C1(O)CCCC1 |
| InChI | InChI=1S/C22H40N2O4/c1-19(2,3)17(21(27)11-7-8-12-21)23-15(25)16(26)24-18(20(4,5)6)22(28)13-9-10-14-22/h17-18,27-28H,7-14H2,1-6H3,(H,23,25)(H,24,26)/t17-,18-/m1/s1 |
| InChIKey | ZBVLLQGHZQBGRK-QZTJIDSGSA-N |
| XLogP | 2.66 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|