C19H14ClF2NO3S — CID 69012189
4-[[2-(4-chlorophenyl)sulfonylphenyl]methylamino]-2,6-difluorophenol (PubChem CID 69012189) has the molecular formula C19H14ClF2NO3S and a molecular weight of 409.84 g/mol. Its IUPAC name is 4-[[2-(4-chlorophenyl)sulfonylphenyl]methylamino]-2,6-difluorophenol.
| Compound Name | 4-[[2-(4-chlorophenyl)sulfonylphenyl]methylamino]-2,6-difluorophenol |
|---|---|
| PubChem CID | 69012189 |
| Molecular Formula | C19H14ClF2NO3S |
| Molecular Weight | 409.84 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 4-[[2-(4-chlorophenyl)sulfonylphenyl]methylamino]-2,6-difluorophenol |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)c1ccccc1CNc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C19H14ClF2NO3S/c20-13-5-7-15(8-6-13)27(25,26)18-4-2-1-3-12(18)11-23-14-9-16(21)19(24)17(22)10-14/h1-10,23-24H,11H2 |
| InChIKey | CZDIFDDYYBPQIP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.84 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|