C19H14Cl3NO3S — CID 69012492
2,6-dichloro-4-[[2-(4-chlorophenyl)sulfonylphenyl]methylamino]phenol (PubChem CID 69012492) has the molecular formula C19H14Cl3NO3S and a molecular weight of 442.75 g/mol. Its IUPAC name is 2,6-dichloro-4-[[2-(4-chlorophenyl)sulfonylphenyl]methylamino]phenol.
| Compound Name | 2,6-dichloro-4-[[2-(4-chlorophenyl)sulfonylphenyl]methylamino]phenol |
|---|---|
| PubChem CID | 69012492 |
| Molecular Formula | C19H14Cl3NO3S |
| Molecular Weight | 442.75 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | 2,6-dichloro-4-[[2-(4-chlorophenyl)sulfonylphenyl]methylamino]phenol |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)c1ccccc1CNc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C19H14Cl3NO3S/c20-13-5-7-15(8-6-13)27(25,26)18-4-2-1-3-12(18)11-23-14-9-16(21)19(24)17(22)10-14/h1-10,23-24H,11H2 |
| InChIKey | MNFZNGCRYNICLL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.75 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|