C25H24N4O — CID 69014504
N-[(2S)-1-amino-3-(4-phenylphenyl)propan-2-yl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide (PubChem CID 69014504) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[(2S)-1-amino-3-(4-phenylphenyl)propan-2-yl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide.
| Compound Name | N-[(2S)-1-amino-3-(4-phenylphenyl)propan-2-yl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 69014504 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[(2S)-1-amino-3-(4-phenylphenyl)propan-2-yl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide |
| SMILES | NC[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)C=Cc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C25H24N4O/c26-16-22(15-18-8-10-20(11-9-18)19-5-2-1-3-6-19)29-24(30)13-12-21-17-28-25-23(21)7-4-14-27-25/h1-14,17,22H,15-16,26H2,(H,27,28)(H,29,30)/t22-/m0/s1 |
| InChIKey | BMZJZDLGXMJKKY-QFIPXVFZSA-N |
| XLogP | 3.93 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|