C19H21Cl3N4O — CID 42635925
(E)-N-[(2S)-1-amino-3-(4-chlorophenyl)propan-2-yl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide;dihydrochloride (PubChem CID 42635925) has the molecular formula C19H21Cl3N4O and a molecular weight of 427.76 g/mol. Its IUPAC name is (E)-N-[(2S)-1-amino-3-(4-chlorophenyl)propan-2-yl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide;dihydrochloride.
| Compound Name | (E)-N-[(2S)-1-amino-3-(4-chlorophenyl)propan-2-yl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide;dihydrochloride |
|---|---|
| PubChem CID | 42635925 |
| Molecular Formula | C19H21Cl3N4O |
| Molecular Weight | 427.76 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | (E)-N-[(2S)-1-amino-3-(4-chlorophenyl)propan-2-yl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enamide;dihydrochloride |
| SMILES | Cl.Cl.NC[C@H](Cc1ccc(Cl)cc1)NC(=O)/C=C/c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C19H19ClN4O.2ClH/c20-15-6-3-13(4-7-15)10-16(11-21)24-18(25)8-5-14-12-23-19-17(14)2-1-9-22-19;;/h1-9,12,16H,10-11,21H2,(H,22,23)(H,24,25);2*1H/b8-5+;;/t16-;;/m0../s1 |
| InChIKey | TWHHGXMTEBPWIP-XPKVHMPRSA-N |
| XLogP | 3.76 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.76 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|