C24H28N4O3 — CID 69082890
tert-butyl N-[(2S)-3-phenyl-2-[3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoylamino]propyl]carbamate (PubChem CID 69082890) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-phenyl-2-[3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-phenyl-2-[3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoylamino]propyl]carbamate |
|---|---|
| PubChem CID | 69082890 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | tert-butyl N-[(2S)-3-phenyl-2-[3-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enoylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H](Cc1ccccc1)NC(=O)C=Cc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C24H28N4O3/c1-24(2,3)31-23(30)27-16-19(14-17-8-5-4-6-9-17)28-21(29)12-11-18-15-26-22-20(18)10-7-13-25-22/h4-13,15,19H,14,16H2,1-3H3,(H,25,26)(H,27,30)(H,28,29)/t19-/m0/s1 |
| InChIKey | CDMCQMUCSIIBJA-IBGZPJMESA-N |
| XLogP | 3.83 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|