C22H25NO6 — CID 69020148
4-[5-butanoyloxy-2-(phenylmethoxycarbonylamino)phenyl]butanoic acid (PubChem CID 69020148) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is 4-[5-butanoyloxy-2-(phenylmethoxycarbonylamino)phenyl]butanoic acid.
| Compound Name | 4-[5-butanoyloxy-2-(phenylmethoxycarbonylamino)phenyl]butanoic acid |
|---|---|
| PubChem CID | 69020148 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-[5-butanoyloxy-2-(phenylmethoxycarbonylamino)phenyl]butanoic acid |
| SMILES | CCCC(=O)Oc1ccc(NC(=O)OCc2ccccc2)c(CCCC(=O)O)c1 |
| InChI | InChI=1S/C22H25NO6/c1-2-7-21(26)29-18-12-13-19(17(14-18)10-6-11-20(24)25)23-22(27)28-15-16-8-4-3-5-9-16/h3-5,8-9,12-14H,2,6-7,10-11,15H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | KIESCVQRVCQXEG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|