C20H22N2O5 — CID 66926727
[5-carbamoyl-2-(phenylmethoxycarbonylamino)phenyl] pentanoate (PubChem CID 66926727) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is [5-carbamoyl-2-(phenylmethoxycarbonylamino)phenyl] pentanoate.
| Compound Name | [5-carbamoyl-2-(phenylmethoxycarbonylamino)phenyl] pentanoate |
|---|---|
| PubChem CID | 66926727 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [5-carbamoyl-2-(phenylmethoxycarbonylamino)phenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1cc(C(N)=O)ccc1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H22N2O5/c1-2-3-9-18(23)27-17-12-15(19(21)24)10-11-16(17)22-20(25)26-13-14-7-5-4-6-8-14/h4-8,10-12H,2-3,9,13H2,1H3,(H2,21,24)(H,22,25) |
| InChIKey | VCABEJSELCACLK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|