C24H34N2O — CID 69020441
2-(2-methylpiperidin-1-yl)-N-[(5S,7R)-3-phenyl-1-adamantyl]acetamide (PubChem CID 69020441) has the molecular formula C24H34N2O and a molecular weight of 366.55 g/mol. Its IUPAC name is 2-(2-methylpiperidin-1-yl)-N-[(5S,7R)-3-phenyl-1-adamantyl]acetamide.
| Compound Name | 2-(2-methylpiperidin-1-yl)-N-[(5S,7R)-3-phenyl-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 69020441 |
| Molecular Formula | C24H34N2O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | 2-(2-methylpiperidin-1-yl)-N-[(5S,7R)-3-phenyl-1-adamantyl]acetamide |
| SMILES | CC1CCCCN1CC(=O)NC12C[C@H]3C[C@@H](C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C24H34N2O/c1-18-7-5-6-10-26(18)16-22(27)25-24-14-19-11-20(15-24)13-23(12-19,17-24)21-8-3-2-4-9-21/h2-4,8-9,18-20H,5-7,10-17H2,1H3,(H,25,27)/t18?,19-,20+,23?,24? |
| InChIKey | TZLBZSUQJBFEBO-UDMDOTTCSA-N |
| XLogP | 4.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |