C24H19BrClNO4 — CID 69021146
N-[2-benzoyl-4-[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]phenyl]-2-bromoacetamide (PubChem CID 69021146) has the molecular formula C24H19BrClNO4 and a molecular weight of 500.78 g/mol. Its IUPAC name is N-[2-benzoyl-4-[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]phenyl]-2-bromoacetamide.
| Compound Name | N-[2-benzoyl-4-[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]phenyl]-2-bromoacetamide |
|---|---|
| PubChem CID | 69021146 |
| Molecular Formula | C24H19BrClNO4 |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | N-[2-benzoyl-4-[2-(4-chlorophenyl)-1,3-dioxolan-2-yl]phenyl]-2-bromoacetamide |
| SMILES | O=C(CBr)Nc1ccc(C2(c3ccc(Cl)cc3)OCCO2)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H19BrClNO4/c25-15-22(28)27-21-11-8-18(14-20(21)23(29)16-4-2-1-3-5-16)24(30-12-13-31-24)17-6-9-19(26)10-7-17/h1-11,14H,12-13,15H2,(H,27,28) |
| InChIKey | IXAPXILRQAMJRW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|