C22H23ClN2O6S — CID 69022502
2-[[2-benzyl-3-[(4-chlorophenyl)sulfonylamino]-3-oxopropyl]-but-3-enoylamino]acetic acid (PubChem CID 69022502) has the molecular formula C22H23ClN2O6S and a molecular weight of 478.95 g/mol. Its IUPAC name is 2-[[2-benzyl-3-[(4-chlorophenyl)sulfonylamino]-3-oxopropyl]-but-3-enoylamino]acetic acid.
| Compound Name | 2-[[2-benzyl-3-[(4-chlorophenyl)sulfonylamino]-3-oxopropyl]-but-3-enoylamino]acetic acid |
|---|---|
| PubChem CID | 69022502 |
| Molecular Formula | C22H23ClN2O6S |
| Molecular Weight | 478.95 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2-[[2-benzyl-3-[(4-chlorophenyl)sulfonylamino]-3-oxopropyl]-but-3-enoylamino]acetic acid |
| SMILES | C=CCC(=O)N(CC(=O)O)CC(Cc1ccccc1)C(=O)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN2O6S/c1-2-6-20(26)25(15-21(27)28)14-17(13-16-7-4-3-5-8-16)22(29)24-32(30,31)19-11-9-18(23)10-12-19/h2-5,7-12,17H,1,6,13-15H2,(H,24,29)(H,27,28) |
| InChIKey | GKNQRVUDZRXNMQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.95 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|