C17H18F4N2O — CID 69023492
3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(4-prop-2-enylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 69023492) has the molecular formula C17H18F4N2O and a molecular weight of 342.34 g/mol. Its IUPAC name is 3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(4-prop-2-enylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | 3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(4-prop-2-enylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69023492 |
| Molecular Formula | C17H18F4N2O |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(4-prop-2-enylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | C=CCN1CCN(C(=O)C=Cc2ccc(F)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H18F4N2O/c1-2-7-22-8-10-23(11-9-22)16(24)6-4-13-3-5-15(18)14(12-13)17(19,20)21/h2-6,12H,1,7-11H2 |
| InChIKey | RKUWAFVXMRXJLX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|