C25H21N3O7S — CID 6902432
N-[(E)-[1,2-bis(furan-2-yl)-2-oxoethylidene]amino]-4-[(4-ethoxyphenyl)sulfonylamino]benzamide (PubChem CID 6902432) has the molecular formula C25H21N3O7S and a molecular weight of 507.52 g/mol. Its IUPAC name is N-[(E)-[1,2-bis(furan-2-yl)-2-oxoethylidene]amino]-4-[(4-ethoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-[(E)-[1,2-bis(furan-2-yl)-2-oxoethylidene]amino]-4-[(4-ethoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 6902432 |
| Molecular Formula | C25H21N3O7S |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | N-[(E)-[1,2-bis(furan-2-yl)-2-oxoethylidene]amino]-4-[(4-ethoxyphenyl)sulfonylamino]benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(C(=O)N/N=C(/C(=O)c3ccco3)c3ccco3)cc2)cc1 |
| InChI | InChI=1S/C25H21N3O7S/c1-2-33-19-11-13-20(14-12-19)36(31,32)28-18-9-7-17(8-10-18)25(30)27-26-23(21-5-3-15-34-21)24(29)22-6-4-16-35-22/h3-16,28H,2H2,1H3,(H,27,30)/b26-23+ |
| InChIKey | LOKPGWCJWPERFY-WNAAXNPUSA-N |
| XLogP | 4.09 |
| TPSA | 140.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|