C26H25N5O4S — CID 6056611
4-[(4-ethoxyphenyl)sulfonylamino]-N-[(Z)-1-(4-imidazol-1-ylphenyl)ethylideneamino]benzamide (PubChem CID 6056611) has the molecular formula C26H25N5O4S and a molecular weight of 503.58 g/mol. Its IUPAC name is 4-[(4-ethoxyphenyl)sulfonylamino]-N-[(Z)-1-(4-imidazol-1-ylphenyl)ethylideneamino]benzamide.
| Compound Name | 4-[(4-ethoxyphenyl)sulfonylamino]-N-[(Z)-1-(4-imidazol-1-ylphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 6056611 |
| Molecular Formula | C26H25N5O4S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 4-[(4-ethoxyphenyl)sulfonylamino]-N-[(Z)-1-(4-imidazol-1-ylphenyl)ethylideneamino]benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(C(=O)N/N=C(/C)c3ccc(-n4ccnc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H25N5O4S/c1-3-35-24-12-14-25(15-13-24)36(33,34)30-22-8-4-21(5-9-22)26(32)29-28-19(2)20-6-10-23(11-7-20)31-17-16-27-18-31/h4-18,30H,3H2,1-2H3,(H,29,32)/b28-19- |
| InChIKey | ZCWQSZZHDHLACI-USHMODERSA-N |
| XLogP | 4.23 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|