C20H18F3N3O4S — CID 69025270
3-[aminooxy-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]methyl]benzonitrile (PubChem CID 69025270) has the molecular formula C20H18F3N3O4S and a molecular weight of 453.44 g/mol. Its IUPAC name is 3-[aminooxy-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]methyl]benzonitrile.
| Compound Name | 3-[aminooxy-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 69025270 |
| Molecular Formula | C20H18F3N3O4S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 3-[aminooxy-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]methyl]benzonitrile |
| SMILES | N#Cc1cccc(C(ON)=C2CCN(S(=O)(=O)c3ccc(OC(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C20H18F3N3O4S/c21-20(22,23)29-17-4-6-18(7-5-17)31(27,28)26-10-8-15(9-11-26)19(30-25)16-3-1-2-14(12-16)13-24/h1-7,12H,8-11,25H2 |
| InChIKey | CVFPFYPNUSTZDT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|