C27H32O10 — CID 69025459
2,2-bis(1-phenylmethoxycarbonyloxyethyl)heptanedioic acid (PubChem CID 69025459) has the molecular formula C27H32O10 and a molecular weight of 516.54 g/mol. Its IUPAC name is 2,2-bis(1-phenylmethoxycarbonyloxyethyl)heptanedioic acid.
| Compound Name | 2,2-bis(1-phenylmethoxycarbonyloxyethyl)heptanedioic acid |
|---|---|
| PubChem CID | 69025459 |
| Molecular Formula | C27H32O10 |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 2,2-bis(1-phenylmethoxycarbonyloxyethyl)heptanedioic acid |
| SMILES | CC(OC(=O)OCc1ccccc1)C(CCCCC(=O)O)(C(=O)O)C(C)OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H32O10/c1-19(36-25(32)34-17-21-11-5-3-6-12-21)27(24(30)31,16-10-9-15-23(28)29)20(2)37-26(33)35-18-22-13-7-4-8-14-22/h3-8,11-14,19-20H,9-10,15-18H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | UFBHBMFCWKXDGL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|