C28H34O10 — CID 69023844
8-phenylmethoxycarbonyloxy-7-(1-phenylmethoxycarbonyloxyethoxycarbonyl)nonanoic acid (PubChem CID 69023844) has the molecular formula C28H34O10 and a molecular weight of 530.57 g/mol. Its IUPAC name is 8-phenylmethoxycarbonyloxy-7-(1-phenylmethoxycarbonyloxyethoxycarbonyl)nonanoic acid.
| Compound Name | 8-phenylmethoxycarbonyloxy-7-(1-phenylmethoxycarbonyloxyethoxycarbonyl)nonanoic acid |
|---|---|
| PubChem CID | 69023844 |
| Molecular Formula | C28H34O10 |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 8-phenylmethoxycarbonyloxy-7-(1-phenylmethoxycarbonyloxyethoxycarbonyl)nonanoic acid |
| SMILES | CC(OC(=O)OCc1ccccc1)OC(=O)C(CCCCCC(=O)O)C(C)OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H34O10/c1-20(36-27(32)34-18-22-12-6-3-7-13-22)24(16-10-5-11-17-25(29)30)26(31)37-21(2)38-28(33)35-19-23-14-8-4-9-15-23/h3-4,6-9,12-15,20-21,24H,5,10-11,16-19H2,1-2H3,(H,29,30) |
| InChIKey | CWJOOYCCAHYYRE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|