C17H16N4S — CID 6902614
(E)-N-ethyl-4-phenyl-3-[(E)-pyridin-2-ylmethylideneamino]-1,3-thiazol-2-imine (PubChem CID 6902614) has the molecular formula C17H16N4S and a molecular weight of 308.41 g/mol. Its IUPAC name is (E)-N-ethyl-4-phenyl-3-[(E)-pyridin-2-ylmethylideneamino]-1,3-thiazol-2-imine.
| Compound Name | (E)-N-ethyl-4-phenyl-3-[(E)-pyridin-2-ylmethylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 6902614 |
| Molecular Formula | C17H16N4S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (E)-N-ethyl-4-phenyl-3-[(E)-pyridin-2-ylmethylideneamino]-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccccc2)n1/N=C/c1ccccn1 |
| InChI | InChI=1S/C17H16N4S/c1-2-18-17-21(20-12-15-10-6-7-11-19-15)16(13-22-17)14-8-4-3-5-9-14/h3-13H,2H2,1H3/b18-17-,20-12+ |
| InChIKey | ABYYMJRWMWVUQX-DONCZSHCSA-N |
| XLogP | 3.41 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|