C19H23BrN4S — CID 70693935
3-pentyl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrobromide (PubChem CID 70693935) has the molecular formula C19H23BrN4S and a molecular weight of 419.39 g/mol. Its IUPAC name is 3-pentyl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrobromide.
| Compound Name | 3-pentyl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrobromide |
|---|---|
| PubChem CID | 70693935 |
| Molecular Formula | C19H23BrN4S |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 3-pentyl-2-phenyl-N-(pyridin-3-ylmethyl)-1,2,4-thiadiazol-5-imine;hydrobromide |
| SMILES | Br.CCCCCc1n/c(=N\Cc2cccnc2)sn1-c1ccccc1 |
| InChI | InChI=1S/C19H22N4S.BrH/c1-2-3-5-12-18-22-19(21-15-16-9-8-13-20-14-16)24-23(18)17-10-6-4-7-11-17;/h4,6-11,13-14H,2-3,5,12,15H2,1H3;1H/b21-19+; |
| InChIKey | HQRNKUZRMBYADA-UXJRWBAGSA-N |
| XLogP | 4.74 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|