About 3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine
3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine (PubChem CID 11010423) has the molecular formula C16H17N3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine.
Molecular Properties
| Compound Name | 3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine |
| PubChem CID | 11010423 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine |
| SMILES | c1ccc(CN2CCN=C2Cc2cccnc2)cc1 |
| InChI | InChI=1S/C16H17N3/c1-2-5-14(6-3-1)13-19-10-9-18-16(19)11-15-7-4-8-17-12-15/h1-8,12H,9-11,13H2 |
| InChIKey | BAFTWOGRWKGOHB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine?
The IUPAC name of 3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine (CID 11010423) is 3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine.
What is the SMILES notation for 3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine?
The canonical SMILES for 3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine is c1ccc(CN2CCN=C2Cc2cccnc2)cc1.
What is the InChIKey of 3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine?
The InChIKey is BAFTWOGRWKGOHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3/c1-2-5-14(6-3-1)13-19-10-9-18-16(19)11-15-7-4-8-17-12-15/h1-8,12H,9-11,13H2.
What are the key properties of 3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine?
3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine has a molecular weight of 251.33 g/mol, XLogP of 2.54, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-benzyl-4,5-dihydroimidazol-2-yl)methyl]pyridine is sourced from PubChem (CID 11010423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).