C24H27N3OS — CID 69030903
[4-[5-(aminomethyl)thiophen-2-yl]piperidin-1-yl]-[5-(1-phenylethyl)-3-pyridinyl]methanone (PubChem CID 69030903) has the molecular formula C24H27N3OS and a molecular weight of 405.57 g/mol. Its IUPAC name is [4-[5-(aminomethyl)thiophen-2-yl]piperidin-1-yl]-[5-(1-phenylethyl)-3-pyridinyl]methanone.
| Compound Name | [4-[5-(aminomethyl)thiophen-2-yl]piperidin-1-yl]-[5-(1-phenylethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 69030903 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | [4-[5-(aminomethyl)thiophen-2-yl]piperidin-1-yl]-[5-(1-phenylethyl)-3-pyridinyl]methanone |
| SMILES | CC(c1ccccc1)c1cncc(C(=O)N2CCC(c3ccc(CN)s3)CC2)c1 |
| InChI | InChI=1S/C24H27N3OS/c1-17(18-5-3-2-4-6-18)20-13-21(16-26-15-20)24(28)27-11-9-19(10-12-27)23-8-7-22(14-25)29-23/h2-8,13,15-17,19H,9-12,14,25H2,1H3 |
| InChIKey | WUDCPIYITSCCRX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |