About [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate
[6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate (PubChem CID 69033925) has the molecular formula C22H17BrFN5O3
and a molecular weight of 498.31 g/mol. Its IUPAC name is [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate.
Molecular Properties
| Compound Name | [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate |
| PubChem CID | 69033925 |
| Molecular Formula | C22H17BrFN5O3 |
| Molecular Weight | 498.31 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate |
| SMILES | O=C(NCCO)Oc1nc2nc(Nc3ccc(F)cc3)ncc2cc1-c1ccccc1Br |
| InChI | InChI=1S/C22H17BrFN5O3/c23-18-4-2-1-3-16(18)17-11-13-12-26-21(27-15-7-5-14(24)6-8-15)29-19(13)28-20(17)32-22(31)25-9-10-30/h1-8,11-12,30H,9-10H2,(H,25,31)(H,26,27,28,29) |
| InChIKey | ZUVTUYIJEZQAFZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate?
The IUPAC name of [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate (CID 69033925) is [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate.
What is the SMILES notation for [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate?
The canonical SMILES for [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate is O=C(NCCO)Oc1nc2nc(Nc3ccc(F)cc3)ncc2cc1-c1ccccc1Br.
What is the InChIKey of [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate?
The InChIKey is ZUVTUYIJEZQAFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17BrFN5O3/c23-18-4-2-1-3-16(18)17-11-13-12-26-21(27-15-7-5-14(24)6-8-15)29-19(13)28-20(17)32-22(31)25-9-10-30/h1-8,11-12,30H,9-10H2,(H,25,31)(H,26,27,28,29).
What are the key properties of [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate?
[6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate has a molecular weight of 498.31 g/mol, XLogP of 4.42, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(2-hydroxyethyl)carbamate is sourced from PubChem (CID 69033925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).