C23H19BrFN5O3 — CID 69034327
[6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(3-hydroxypropyl)carbamate (PubChem CID 69034327) has the molecular formula C23H19BrFN5O3 and a molecular weight of 512.34 g/mol. Its IUPAC name is [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(3-hydroxypropyl)carbamate.
| Compound Name | [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(3-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 69034327 |
| Molecular Formula | C23H19BrFN5O3 |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-(3-hydroxypropyl)carbamate |
| SMILES | O=C(NCCCO)Oc1nc2nc(Nc3ccc(F)cc3)ncc2cc1-c1ccccc1Br |
| InChI | InChI=1S/C23H19BrFN5O3/c24-19-5-2-1-4-17(19)18-12-14-13-27-22(28-16-8-6-15(25)7-9-16)30-20(14)29-21(18)33-23(32)26-10-3-11-31/h1-2,4-9,12-13,31H,3,10-11H2,(H,26,32)(H,27,28,29,30) |
| InChIKey | NNWCTNNBGUAWCO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|