C30H30FNO4 — CID 69039583
[4-[5-[(5-fluoro-2-methylphenyl)-hydroxymethyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] prop-2-enoate (PubChem CID 69039583) has the molecular formula C30H30FNO4 and a molecular weight of 487.57 g/mol. Its IUPAC name is [4-[5-[(5-fluoro-2-methylphenyl)-hydroxymethyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] prop-2-enoate.
| Compound Name | [4-[5-[(5-fluoro-2-methylphenyl)-hydroxymethyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] prop-2-enoate |
|---|---|
| PubChem CID | 69039583 |
| Molecular Formula | C30H30FNO4 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | [4-[5-[(5-fluoro-2-methylphenyl)-hydroxymethyl]-2,2,4-trimethyl-1H-quinolin-6-yl]-3-methoxyphenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc3c(c2C(O)c2cc(F)ccc2C)C(C)=CC(C)(C)N3)c(OC)c1 |
| InChI | InChI=1S/C30H30FNO4/c1-7-26(33)36-20-10-11-21(25(15-20)35-6)22-12-13-24-27(18(3)16-30(4,5)32-24)28(22)29(34)23-14-19(31)9-8-17(23)2/h7-16,29,32,34H,1H2,2-6H3 |
| InChIKey | GHWJYUDRDNAGRJ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|