C26H25FN2O3 — CID 87388433
[[6-(4-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]-pyridin-4-ylmethyl] formate (PubChem CID 87388433) has the molecular formula C26H25FN2O3 and a molecular weight of 432.50 g/mol. Its IUPAC name is [[6-(4-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]-pyridin-4-ylmethyl] formate.
| Compound Name | [[6-(4-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]-pyridin-4-ylmethyl] formate |
|---|---|
| PubChem CID | 87388433 |
| Molecular Formula | C26H25FN2O3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [[6-(4-fluoro-2-methoxyphenyl)-2,2,4-trimethyl-1H-quinolin-5-yl]-pyridin-4-ylmethyl] formate |
| SMILES | COc1cc(F)ccc1-c1ccc2c(c1C(OC=O)c1ccncc1)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C26H25FN2O3/c1-16-14-26(2,3)29-21-8-7-20(19-6-5-18(27)13-22(19)31-4)24(23(16)21)25(32-15-30)17-9-11-28-12-10-17/h5-15,25,29H,1-4H3 |
| InChIKey | PLGNKOZXZWQLHA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|