C29H37N3O4 — CID 69040699
N-(3-ethoxypropyl)-2-[1-[2-[2-(5-oxocyclohexa-1,3-dien-1-yl)-1,4-oxazin-4-yl]ethyl]piperidin-4-yl]benzamide (PubChem CID 69040699) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[1-[2-[2-(5-oxocyclohexa-1,3-dien-1-yl)-1,4-oxazin-4-yl]ethyl]piperidin-4-yl]benzamide.
| Compound Name | N-(3-ethoxypropyl)-2-[1-[2-[2-(5-oxocyclohexa-1,3-dien-1-yl)-1,4-oxazin-4-yl]ethyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 69040699 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[1-[2-[2-(5-oxocyclohexa-1,3-dien-1-yl)-1,4-oxazin-4-yl]ethyl]piperidin-4-yl]benzamide |
| SMILES | CCOCCCNC(=O)c1ccccc1C1CCN(CCN2C=COC(C3=CC=CC(=O)C3)=C2)CC1 |
| InChI | InChI=1S/C29H37N3O4/c1-2-35-19-6-13-30-29(34)27-10-4-3-9-26(27)23-11-14-31(15-12-23)16-17-32-18-20-36-28(22-32)24-7-5-8-25(33)21-24/h3-5,7-10,18,20,22-23H,2,6,11-17,19,21H2,1H3,(H,30,34) |
| InChIKey | VOUKLUGZXIDAQI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|