C34H39N3O3 — CID 90896625
2-[1-[2-[2-(3-hydroxyphenyl)-1,4-oxazin-4-yl]ethyl]piperidin-4-yl]-N-(4-phenylbutyl)benzamide (PubChem CID 90896625) has the molecular formula C34H39N3O3 and a molecular weight of 537.70 g/mol. Its IUPAC name is 2-[1-[2-[2-(3-hydroxyphenyl)-1,4-oxazin-4-yl]ethyl]piperidin-4-yl]-N-(4-phenylbutyl)benzamide.
| Compound Name | 2-[1-[2-[2-(3-hydroxyphenyl)-1,4-oxazin-4-yl]ethyl]piperidin-4-yl]-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 90896625 |
| Molecular Formula | C34H39N3O3 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | 2-[1-[2-[2-(3-hydroxyphenyl)-1,4-oxazin-4-yl]ethyl]piperidin-4-yl]-N-(4-phenylbutyl)benzamide |
| SMILES | O=C(NCCCCc1ccccc1)c1ccccc1C1CCN(CCN2C=COC(c3cccc(O)c3)=C2)CC1 |
| InChI | InChI=1S/C34H39N3O3/c38-30-13-8-12-29(25-30)33-26-37(23-24-40-33)22-21-36-19-16-28(17-20-36)31-14-4-5-15-32(31)34(39)35-18-7-6-11-27-9-2-1-3-10-27/h1-5,8-10,12-15,23-26,28,38H,6-7,11,16-22H2,(H,35,39) |
| InChIKey | RIJZNZNSPQNYKJ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|