C27H32N2O2 — CID 69042396
N-ethyl-N'-[4-[3-(1-methoxy-2-phenylethyl)phenoxy]-2,5-dimethylphenyl]-N-methylmethanimidamide (PubChem CID 69042396) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-ethyl-N'-[4-[3-(1-methoxy-2-phenylethyl)phenoxy]-2,5-dimethylphenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[4-[3-(1-methoxy-2-phenylethyl)phenoxy]-2,5-dimethylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 69042396 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | N-ethyl-N'-[4-[3-(1-methoxy-2-phenylethyl)phenoxy]-2,5-dimethylphenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2cccc(C(Cc3ccccc3)OC)c2)cc1C |
| InChI | InChI=1S/C27H32N2O2/c1-6-29(4)19-28-25-15-21(3)26(16-20(25)2)31-24-14-10-13-23(18-24)27(30-5)17-22-11-8-7-9-12-22/h7-16,18-19,27H,6,17H2,1-5H3/b28-19+ |
| InChIKey | AYPLEJJZQQOMRH-TURZUDJPSA-N |
| XLogP | 6.64 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|