C18H17ClF4INO2S2 — CID 69042917
N-[3-(2-chloro-4-fluorophenyl)sulfanyl-1,1,1-trifluoro-2-iodopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 69042917) has the molecular formula C18H17ClF4INO2S2 and a molecular weight of 581.82 g/mol. Its IUPAC name is N-[3-(2-chloro-4-fluorophenyl)sulfanyl-1,1,1-trifluoro-2-iodopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[3-(2-chloro-4-fluorophenyl)sulfanyl-1,1,1-trifluoro-2-iodopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 69042917 |
| Molecular Formula | C18H17ClF4INO2S2 |
| Molecular Weight | 581.82 g/mol |
| Exact Mass | 580.94 |
| IUPAC Name | N-[3-(2-chloro-4-fluorophenyl)sulfanyl-1,1,1-trifluoro-2-iodopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC(I)(CSc2ccc(F)cc2Cl)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C18H17ClF4INO2S2/c1-10-6-11(2)16(12(3)7-10)29(26,27)25-17(24,18(21,22)23)9-28-15-5-4-13(20)8-14(15)19/h4-8,25H,9H2,1-3H3 |
| InChIKey | GPSANYRBSFIEQI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.82 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|