C19H20ClF3INO3S — CID 69046271
N-[3-(5-chloro-2-methylphenoxy)-1,1,1-trifluoro-2-iodopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 69046271) has the molecular formula C19H20ClF3INO3S and a molecular weight of 561.79 g/mol. Its IUPAC name is N-[3-(5-chloro-2-methylphenoxy)-1,1,1-trifluoro-2-iodopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[3-(5-chloro-2-methylphenoxy)-1,1,1-trifluoro-2-iodopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 69046271 |
| Molecular Formula | C19H20ClF3INO3S |
| Molecular Weight | 561.79 g/mol |
| Exact Mass | 560.98 |
| IUPAC Name | N-[3-(5-chloro-2-methylphenoxy)-1,1,1-trifluoro-2-iodopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC(I)(COc2cc(Cl)ccc2C)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C19H20ClF3INO3S/c1-11-7-13(3)17(14(4)8-11)29(26,27)25-18(24,19(21,22)23)10-28-16-9-15(20)6-5-12(16)2/h5-9,25H,10H2,1-4H3 |
| InChIKey | HYGZCCQZTJKXBA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.79 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|