C18H18BrF3INO3S — CID 69044673
N-[3-(4-bromophenoxy)-1,1,1-trifluoro-2-iodopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 69044673) has the molecular formula C18H18BrF3INO3S and a molecular weight of 592.22 g/mol. Its IUPAC name is N-[3-(4-bromophenoxy)-1,1,1-trifluoro-2-iodopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[3-(4-bromophenoxy)-1,1,1-trifluoro-2-iodopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 69044673 |
| Molecular Formula | C18H18BrF3INO3S |
| Molecular Weight | 592.22 g/mol |
| Exact Mass | 590.92 |
| IUPAC Name | N-[3-(4-bromophenoxy)-1,1,1-trifluoro-2-iodopropan-2-yl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC(I)(COc2ccc(Br)cc2)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C18H18BrF3INO3S/c1-11-8-12(2)16(13(3)9-11)28(25,26)24-17(23,18(20,21)22)10-27-15-6-4-14(19)5-7-15/h4-9,24H,10H2,1-3H3 |
| InChIKey | HOGZBGFXFUEGCT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.22 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|