C18H18ClNO2S — CID 90552853
N-[3-(3-chlorophenyl)prop-2-ynyl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 90552853) has the molecular formula C18H18ClNO2S and a molecular weight of 347.87 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)prop-2-ynyl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[3-(3-chlorophenyl)prop-2-ynyl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 90552853 |
| Molecular Formula | C18H18ClNO2S |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-[3-(3-chlorophenyl)prop-2-ynyl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCC#Cc2cccc(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C18H18ClNO2S/c1-13-10-14(2)18(15(3)11-13)23(21,22)20-9-5-7-16-6-4-8-17(19)12-16/h4,6,8,10-12,20H,9H2,1-3H3 |
| InChIKey | BVRLPRNQSQLMLM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|