C15H19F2N3O2 — CID 6904466
1-cyclohexyl-3-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]urea (PubChem CID 6904466) has the molecular formula C15H19F2N3O2 and a molecular weight of 311.33 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]urea.
| Compound Name | 1-cyclohexyl-3-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 6904466 |
| Molecular Formula | C15H19F2N3O2 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 1-cyclohexyl-3-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]urea |
| SMILES | O=C(N/N=C/c1ccccc1OC(F)F)NC1CCCCC1 |
| InChI | InChI=1S/C15H19F2N3O2/c16-14(17)22-13-9-5-4-6-11(13)10-18-20-15(21)19-12-7-2-1-3-8-12/h4-6,9-10,12,14H,1-3,7-8H2,(H2,19,20,21)/b18-10+ |
| InChIKey | MGUYADTYPSJMHK-VCHYOVAHSA-N |
| XLogP | 3.25 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|