C22H29N5O — CID 69045520
4-(3,4-dimethylphenyl)-6-[3-(2-morpholin-4-ylethylamino)propyl]pyrimidine-2-carbonitrile (PubChem CID 69045520) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-6-[3-(2-morpholin-4-ylethylamino)propyl]pyrimidine-2-carbonitrile.
| Compound Name | 4-(3,4-dimethylphenyl)-6-[3-(2-morpholin-4-ylethylamino)propyl]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 69045520 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-6-[3-(2-morpholin-4-ylethylamino)propyl]pyrimidine-2-carbonitrile |
| SMILES | Cc1ccc(-c2cc(CCCNCCN3CCOCC3)nc(C#N)n2)cc1C |
| InChI | InChI=1S/C22H29N5O/c1-17-5-6-19(14-18(17)2)21-15-20(25-22(16-23)26-21)4-3-7-24-8-9-27-10-12-28-13-11-27/h5-6,14-15,24H,3-4,7-13H2,1-2H3 |
| InChIKey | NWLRDZHHEPSVEF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|