C19H19F3N4 — CID 69046496
4-(3-pyrrolidin-1-ylpropyl)-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile (PubChem CID 69046496) has the molecular formula C19H19F3N4 and a molecular weight of 360.38 g/mol. Its IUPAC name is 4-(3-pyrrolidin-1-ylpropyl)-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile.
| Compound Name | 4-(3-pyrrolidin-1-ylpropyl)-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 69046496 |
| Molecular Formula | C19H19F3N4 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 4-(3-pyrrolidin-1-ylpropyl)-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile |
| SMILES | N#Cc1nc(CCCN2CCCC2)cc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C19H19F3N4/c20-19(21,22)15-6-3-5-14(11-15)17-12-16(24-18(13-23)25-17)7-4-10-26-8-1-2-9-26/h3,5-6,11-12H,1-2,4,7-10H2 |
| InChIKey | MLLYLHXGLOPFNR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |