C17H16F3N5O — CID 11523403
1-[3-[2-cyano-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]propyl]-1-methylurea (PubChem CID 11523403) has the molecular formula C17H16F3N5O and a molecular weight of 363.34 g/mol. Its IUPAC name is 1-[3-[2-cyano-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]propyl]-1-methylurea.
| Compound Name | 1-[3-[2-cyano-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]propyl]-1-methylurea |
|---|---|
| PubChem CID | 11523403 |
| Molecular Formula | C17H16F3N5O |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-[3-[2-cyano-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]propyl]-1-methylurea |
| SMILES | CN(CCCc1cc(-c2cccc(C(F)(F)F)c2)nc(C#N)n1)C(N)=O |
| InChI | InChI=1S/C17H16F3N5O/c1-25(16(22)26)7-3-6-13-9-14(24-15(10-21)23-13)11-4-2-5-12(8-11)17(18,19)20/h2,4-5,8-9H,3,6-7H2,1H3,(H2,22,26) |
| InChIKey | DVBSLCSAXPZBEB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |