C14H10F3N5O — CID 68825785
1-[2-cyano-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1-methylurea (PubChem CID 68825785) has the molecular formula C14H10F3N5O and a molecular weight of 321.26 g/mol. Its IUPAC name is 1-[2-cyano-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1-methylurea.
| Compound Name | 1-[2-cyano-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1-methylurea |
|---|---|
| PubChem CID | 68825785 |
| Molecular Formula | C14H10F3N5O |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1-[2-cyano-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]-1-methylurea |
| SMILES | CN(C(N)=O)c1cc(-c2cccc(C(F)(F)F)c2)nc(C#N)n1 |
| InChI | InChI=1S/C14H10F3N5O/c1-22(13(19)23)12-6-10(20-11(7-18)21-12)8-3-2-4-9(5-8)14(15,16)17/h2-6H,1H3,(H2,19,23) |
| InChIKey | HZEHYOAZFQZZHY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |