C21H23F3N4 — CID 69047776
4-[3-(azepan-1-yl)propyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile (PubChem CID 69047776) has the molecular formula C21H23F3N4 and a molecular weight of 388.44 g/mol. Its IUPAC name is 4-[3-(azepan-1-yl)propyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile.
| Compound Name | 4-[3-(azepan-1-yl)propyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 69047776 |
| Molecular Formula | C21H23F3N4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-[3-(azepan-1-yl)propyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile |
| SMILES | N#Cc1nc(CCCN2CCCCCC2)cc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C21H23F3N4/c22-21(23,24)17-8-5-7-16(13-17)19-14-18(26-20(15-25)27-19)9-6-12-28-10-3-1-2-4-11-28/h5,7-8,13-14H,1-4,6,9-12H2 |
| InChIKey | FBKSNFAIVOFCPW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |