C20H24N4S — CID 70973377
4-(3-methyl-5-sulfanylphenyl)-6-(3-piperidin-1-ylpropyl)pyrimidine-2-carbonitrile (PubChem CID 70973377) has the molecular formula C20H24N4S and a molecular weight of 352.51 g/mol. Its IUPAC name is 4-(3-methyl-5-sulfanylphenyl)-6-(3-piperidin-1-ylpropyl)pyrimidine-2-carbonitrile.
| Compound Name | 4-(3-methyl-5-sulfanylphenyl)-6-(3-piperidin-1-ylpropyl)pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 70973377 |
| Molecular Formula | C20H24N4S |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 4-(3-methyl-5-sulfanylphenyl)-6-(3-piperidin-1-ylpropyl)pyrimidine-2-carbonitrile |
| SMILES | Cc1cc(S)cc(-c2cc(CCCN3CCCCC3)nc(C#N)n2)c1 |
| InChI | InChI=1S/C20H24N4S/c1-15-10-16(12-18(25)11-15)19-13-17(22-20(14-21)23-19)6-5-9-24-7-3-2-4-8-24/h10-13,25H,2-9H2,1H3 |
| InChIKey | TXVAORGZNHPRSU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|