C20H14F5N5 — CID 69048465
4-[3-[(3,5-difluoro-2-pyridinyl)amino]propyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile (PubChem CID 69048465) has the molecular formula C20H14F5N5 and a molecular weight of 419.36 g/mol. Its IUPAC name is 4-[3-[(3,5-difluoro-2-pyridinyl)amino]propyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile.
| Compound Name | 4-[3-[(3,5-difluoro-2-pyridinyl)amino]propyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 69048465 |
| Molecular Formula | C20H14F5N5 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 4-[3-[(3,5-difluoro-2-pyridinyl)amino]propyl]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile |
| SMILES | N#Cc1nc(CCCNc2ncc(F)cc2F)cc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H14F5N5/c21-14-8-16(22)19(28-11-14)27-6-2-5-15-9-17(30-18(10-26)29-15)12-3-1-4-13(7-12)20(23,24)25/h1,3-4,7-9,11H,2,5-6H2,(H,27,28) |
| InChIKey | MCXRIQPCZOVYJI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|