C18H19F3N4O — CID 90971200
4-[2-(2-methylpropylamino)ethoxy]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile (PubChem CID 90971200) has the molecular formula C18H19F3N4O and a molecular weight of 364.37 g/mol. Its IUPAC name is 4-[2-(2-methylpropylamino)ethoxy]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile.
| Compound Name | 4-[2-(2-methylpropylamino)ethoxy]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 90971200 |
| Molecular Formula | C18H19F3N4O |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-[2-(2-methylpropylamino)ethoxy]-6-[3-(trifluoromethyl)phenyl]pyrimidine-2-carbonitrile |
| SMILES | CC(C)CNCCOc1cc(-c2cccc(C(F)(F)F)c2)nc(C#N)n1 |
| InChI | InChI=1S/C18H19F3N4O/c1-12(2)11-23-6-7-26-17-9-15(24-16(10-22)25-17)13-4-3-5-14(8-13)18(19,20)21/h3-5,8-9,12,23H,6-7,11H2,1-2H3 |
| InChIKey | NBICNZPNQOTZNY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|