C12H10O4S — CID 69046277
(2-oxo-1,4-benzoxathiin-7-yl) 2-methylprop-2-enoate (PubChem CID 69046277) has the molecular formula C12H10O4S and a molecular weight of 250.27 g/mol. Its IUPAC name is (2-oxo-1,4-benzoxathiin-7-yl) 2-methylprop-2-enoate.
| Compound Name | (2-oxo-1,4-benzoxathiin-7-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 69046277 |
| Molecular Formula | C12H10O4S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | (2-oxo-1,4-benzoxathiin-7-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2c(c1)OC(=O)CS2 |
| InChI | InChI=1S/C12H10O4S/c1-7(2)12(14)15-8-3-4-10-9(5-8)16-11(13)6-17-10/h3-5H,1,6H2,2H3 |
| InChIKey | DZNJYZKPTZPWHD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|