C16H14BrF3N4O2 — CID 69047075
4-[5-(4-bromophenyl)-6-(trifluoromethyl)pyridazin-3-yl]piperazine-1-carboxylic acid (PubChem CID 69047075) has the molecular formula C16H14BrF3N4O2 and a molecular weight of 431.21 g/mol. Its IUPAC name is 4-[5-(4-bromophenyl)-6-(trifluoromethyl)pyridazin-3-yl]piperazine-1-carboxylic acid.
| Compound Name | 4-[5-(4-bromophenyl)-6-(trifluoromethyl)pyridazin-3-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 69047075 |
| Molecular Formula | C16H14BrF3N4O2 |
| Molecular Weight | 431.21 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 4-[5-(4-bromophenyl)-6-(trifluoromethyl)pyridazin-3-yl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2cc(-c3ccc(Br)cc3)c(C(F)(F)F)nn2)CC1 |
| InChI | InChI=1S/C16H14BrF3N4O2/c17-11-3-1-10(2-4-11)12-9-13(21-22-14(12)16(18,19)20)23-5-7-24(8-6-23)15(25)26/h1-4,9H,5-8H2,(H,25,26) |
| InChIKey | SIBQGGUEIRNLDX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |