C18H15F6N3O5S — CID 87276901
4-[5-phenyl-6-(trifluoromethyl)-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]piperazine-1-carboxylic acid (PubChem CID 87276901) has the molecular formula C18H15F6N3O5S and a molecular weight of 499.39 g/mol. Its IUPAC name is 4-[5-phenyl-6-(trifluoromethyl)-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[5-phenyl-6-(trifluoromethyl)-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87276901 |
| Molecular Formula | C18H15F6N3O5S |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 4-[5-phenyl-6-(trifluoromethyl)-2-(trifluoromethylsulfonyloxy)-3-pyridinyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2cc(-c3ccccc3)c(C(F)(F)F)nc2OS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H15F6N3O5S/c19-17(20,21)14-12(11-4-2-1-3-5-11)10-13(26-6-8-27(9-7-26)16(28)29)15(25-14)32-33(30,31)18(22,23)24/h1-5,10H,6-9H2,(H,28,29) |
| InChIKey | LQOSZKOXDJBQDM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|