About (5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane
(5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane (PubChem CID 142961712) has the molecular formula C15H13F3N2O3S
and a molecular weight of 358.34 g/mol. Its IUPAC name is (5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane.
Molecular Properties
| Compound Name | (5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane |
| PubChem CID | 142961712 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | (5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane |
| SMILES | CC.N#Cc1cnc(OS(=O)(=O)C(F)(F)F)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H7F3N2O3S.C2H6/c14-13(15,16)22(19,20)21-12-11(6-9(7-17)8-18-12)10-4-2-1-3-5-10;1-2/h1-6,8H;1-2H3 |
| InChIKey | FHAUZFUGUWIWSX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane?
The IUPAC name of (5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane (CID 142961712) is (5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane.
What is the SMILES notation for (5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane?
The canonical SMILES for (5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane is CC.N#Cc1cnc(OS(=O)(=O)C(F)(F)F)c(-c2ccccc2)c1.
What is the InChIKey of (5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane?
The InChIKey is FHAUZFUGUWIWSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F3N2O3S.C2H6/c14-13(15,16)22(19,20)21-12-11(6-9(7-17)8-18-12)10-4-2-1-3-5-10;1-2/h1-6,8H;1-2H3.
What are the key properties of (5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane?
(5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane has a molecular weight of 358.34 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyano-3-phenyl-2-pyridinyl) trifluoromethanesulfonate;ethane is sourced from PubChem (CID 142961712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).