C22H26ClN3O5S — CID 6904990
ethyl 2-[[2-[(E)-[2-(2-chloro-4,6-dimethylanilino)-2-oxoethylidene]amino]oxyacetyl]amino]-5-propan-2-ylthiophene-3-carboxylate (PubChem CID 6904990) has the molecular formula C22H26ClN3O5S and a molecular weight of 479.99 g/mol. Its IUPAC name is ethyl 2-[[2-[(E)-[2-(2-chloro-4,6-dimethylanilino)-2-oxoethylidene]amino]oxyacetyl]amino]-5-propan-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(E)-[2-(2-chloro-4,6-dimethylanilino)-2-oxoethylidene]amino]oxyacetyl]amino]-5-propan-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 6904990 |
| Molecular Formula | C22H26ClN3O5S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | ethyl 2-[[2-[(E)-[2-(2-chloro-4,6-dimethylanilino)-2-oxoethylidene]amino]oxyacetyl]amino]-5-propan-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(C)C)sc1NC(=O)CO/N=C/C(=O)Nc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C22H26ClN3O5S/c1-6-30-22(29)15-9-17(12(2)3)32-21(15)26-19(28)11-31-24-10-18(27)25-20-14(5)7-13(4)8-16(20)23/h7-10,12H,6,11H2,1-5H3,(H,25,27)(H,26,28)/b24-10+ |
| InChIKey | GNXPDLDDIWKYSY-YSURURNPSA-N |
| XLogP | 4.90 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|