C22H26ClN3O3 — CID 3995977
2-[[2-(2-chloro-4,6-dimethylanilino)-2-oxoethylidene]amino]oxy-N-(4-phenylbutan-2-yl)acetamide (PubChem CID 3995977) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is 2-[[2-(2-chloro-4,6-dimethylanilino)-2-oxoethylidene]amino]oxy-N-(4-phenylbutan-2-yl)acetamide.
| Compound Name | 2-[[2-(2-chloro-4,6-dimethylanilino)-2-oxoethylidene]amino]oxy-N-(4-phenylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 3995977 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-[[2-(2-chloro-4,6-dimethylanilino)-2-oxoethylidene]amino]oxy-N-(4-phenylbutan-2-yl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)C=NOCC(=O)NC(C)CCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-15-11-16(2)22(19(23)12-15)26-20(27)13-24-29-14-21(28)25-17(3)9-10-18-7-5-4-6-8-18/h4-8,11-13,17H,9-10,14H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | PMFVDNUZSVSSRZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|