C18H28N4O3 — CID 69052821
(2R)-2-[[2-amino-4-(diethylcarbamoyl)anilino]methyl]piperidine-1-carboxylic acid (PubChem CID 69052821) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is (2R)-2-[[2-amino-4-(diethylcarbamoyl)anilino]methyl]piperidine-1-carboxylic acid.
| Compound Name | (2R)-2-[[2-amino-4-(diethylcarbamoyl)anilino]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69052821 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (2R)-2-[[2-amino-4-(diethylcarbamoyl)anilino]methyl]piperidine-1-carboxylic acid |
| SMILES | CCN(CC)C(=O)c1ccc(NC[C@H]2CCCCN2C(=O)O)c(N)c1 |
| InChI | InChI=1S/C18H28N4O3/c1-3-21(4-2)17(23)13-8-9-16(15(19)11-13)20-12-14-7-5-6-10-22(14)18(24)25/h8-9,11,14,20H,3-7,10,12,19H2,1-2H3,(H,24,25)/t14-/m1/s1 |
| InChIKey | KHPFMFFDFWNVIP-CQSZACIVSA-N |
| XLogP | 2.70 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|