C23H36N4O5 — CID 142973015
tert-butyl (2R)-2-[[4-(diethylcarbamoyl)-2-nitroanilino]methyl]azepane-1-carboxylate (PubChem CID 142973015) has the molecular formula C23H36N4O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[4-(diethylcarbamoyl)-2-nitroanilino]methyl]azepane-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[4-(diethylcarbamoyl)-2-nitroanilino]methyl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 142973015 |
| Molecular Formula | C23H36N4O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | tert-butyl (2R)-2-[[4-(diethylcarbamoyl)-2-nitroanilino]methyl]azepane-1-carboxylate |
| SMILES | CCN(CC)C(=O)c1ccc(NC[C@H]2CCCCCN2C(=O)OC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H36N4O5/c1-6-25(7-2)21(28)17-12-13-19(20(15-17)27(30)31)24-16-18-11-9-8-10-14-26(18)22(29)32-23(3,4)5/h12-13,15,18,24H,6-11,14,16H2,1-5H3/t18-/m1/s1 |
| InChIKey | OSYSAYYXARQDPI-GOSISDBHSA-N |
| XLogP | 4.67 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|