C21H26F6N4O5 — CID 58874496
tert-butyl (2R)-2-[[4-[bis(2,2,2-trifluoroethyl)carbamoyl]-2-nitroanilino]methyl]pyrrolidine-1-carboxylate (PubChem CID 58874496) has the molecular formula C21H26F6N4O5 and a molecular weight of 528.45 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[4-[bis(2,2,2-trifluoroethyl)carbamoyl]-2-nitroanilino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[4-[bis(2,2,2-trifluoroethyl)carbamoyl]-2-nitroanilino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58874496 |
| Molecular Formula | C21H26F6N4O5 |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | tert-butyl (2R)-2-[[4-[bis(2,2,2-trifluoroethyl)carbamoyl]-2-nitroanilino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1CNc1ccc(C(=O)N(CC(F)(F)F)CC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26F6N4O5/c1-19(2,3)36-18(33)30-8-4-5-14(30)10-28-15-7-6-13(9-16(15)31(34)35)17(32)29(11-20(22,23)24)12-21(25,26)27/h6-7,9,14,28H,4-5,8,10-12H2,1-3H3/t14-/m1/s1 |
| InChIKey | GRROEHMIBHYUMU-CQSZACIVSA-N |
| XLogP | 4.97 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|